C31H39N3O3S — CID 155321028
1-[3-[[(6S)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl]amino]-3-phenylpropyl]piperidine-4-carboxylic acid (PubChem CID 155321028) has the molecular formula C31H39N3O3S and a molecular weight of 533.74 g/mol. Its IUPAC name is 1-[3-[[(6S)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl]amino]-3-phenylpropyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[[(6S)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl]amino]-3-phenylpropyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 155321028 |
| Molecular Formula | C31H39N3O3S |
| Molecular Weight | 533.74 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 1-[3-[[(6S)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl]amino]-3-phenylpropyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)(C)[C@H]1CCc2nc3sc(C(=O)NC(CCN4CCC(C(=O)O)CC4)c4ccccc4)cc3cc2C1 |
| InChI | InChI=1S/C31H39N3O3S/c1-31(2,3)24-9-10-25-22(18-24)17-23-19-27(38-29(23)33-25)28(35)32-26(20-7-5-4-6-8-20)13-16-34-14-11-21(12-15-34)30(36)37/h4-8,17,19,21,24,26H,9-16,18H2,1-3H3,(H,32,35)(H,36,37)/t24-,26?/m0/s1 |
| InChIKey | ZCGQRLMXHQCWJW-QSAPEBAKSA-N |
| XLogP | 6.11 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.74 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |