C32H33N5O — CID 167699566
3,10-bis(2-cyclopentyl-1H-imidazol-5-yl)-12-methyl-6H-indolo[1,2-c][1,3]benzoxazine (PubChem CID 167699566) has the molecular formula C32H33N5O and a molecular weight of 503.65 g/mol. Its IUPAC name is 3,10-bis(2-cyclopentyl-1H-imidazol-5-yl)-12-methyl-6H-indolo[1,2-c][1,3]benzoxazine.
| Compound Name | 3,10-bis(2-cyclopentyl-1H-imidazol-5-yl)-12-methyl-6H-indolo[1,2-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 167699566 |
| Molecular Formula | C32H33N5O |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 3,10-bis(2-cyclopentyl-1H-imidazol-5-yl)-12-methyl-6H-indolo[1,2-c][1,3]benzoxazine |
| SMILES | Cc1c2n(c3ccc(-c4cnc(C5CCCC5)[nH]4)cc13)COc1cc(-c3cnc(C4CCCC4)[nH]3)ccc1-2 |
| InChI | InChI=1S/C32H33N5O/c1-19-25-14-22(26-16-33-31(35-26)20-6-2-3-7-20)11-13-28(25)37-18-38-29-15-23(10-12-24(29)30(19)37)27-17-34-32(36-27)21-8-4-5-9-21/h10-17,20-21H,2-9,18H2,1H3,(H,33,35)(H,34,36) |
| InChIKey | YTNJOLXAWFYZML-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 71.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |