C59H50N4O — CID 167703041
N,N-diphenyl-4-[4-(propylideneamino)phenyl]aniline;2-methyl-4-[[4-[4-(N-phenylanilino)phenyl]phenyl]iminomethyl]phenol (PubChem CID 167703041) has the molecular formula C59H50N4O and a molecular weight of 831.08 g/mol. Its IUPAC name is N,N-diphenyl-4-[4-(propylideneamino)phenyl]aniline;2-methyl-4-[[4-[4-(N-phenylanilino)phenyl]phenyl]iminomethyl]phenol.
| Compound Name | N,N-diphenyl-4-[4-(propylideneamino)phenyl]aniline;2-methyl-4-[[4-[4-(N-phenylanilino)phenyl]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 167703041 |
| Molecular Formula | C59H50N4O |
| Molecular Weight | 831.08 g/mol |
| Exact Mass | 830.40 |
| IUPAC Name | N,N-diphenyl-4-[4-(propylideneamino)phenyl]aniline;2-methyl-4-[[4-[4-(N-phenylanilino)phenyl]phenyl]iminomethyl]phenol |
| SMILES | CC/C=N/c1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1.Cc1cc(/C=N/c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)ccc1O |
| InChI | InChI=1S/C32H26N2O.C27H24N2/c1-24-22-25(12-21-32(24)35)23-33-28-17-13-26(14-18-28)27-15-19-31(20-16-27)34(29-8-4-2-5-9-29)30-10-6-3-7-11-30;1-2-21-28-24-17-13-22(14-18-24)23-15-19-27(20-16-23)29(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h2-23,35H,1H3;3-21H,2H2,1H3/b33-23+;28-21+ |
| InChIKey | YRKDRHYWDXVDGK-MSSIZPHHSA-N |
| XLogP | 16.52 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.08 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|