C27H24N2 — CID 22967567
3-methyl-N-[4-[(4-methylphenyl)iminomethyl]phenyl]-N-phenylaniline (PubChem CID 22967567) has the molecular formula C27H24N2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-methyl-N-[4-[(4-methylphenyl)iminomethyl]phenyl]-N-phenylaniline.
| Compound Name | 3-methyl-N-[4-[(4-methylphenyl)iminomethyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 22967567 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-methyl-N-[4-[(4-methylphenyl)iminomethyl]phenyl]-N-phenylaniline |
| SMILES | Cc1ccc(/N=C/c2ccc(N(c3ccccc3)c3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C27H24N2/c1-21-11-15-24(16-12-21)28-20-23-13-17-26(18-14-23)29(25-8-4-3-5-9-25)27-10-6-7-22(2)19-27/h3-20H,1-2H3/b28-20+ |
| InChIKey | QGJWAKJOWMAZOO-VFCFBJKWSA-N |
| XLogP | 7.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|