C23H44O3 — CID 167703724
3-(2,2-diethylbutoxymethyl)-3-ethylpentane;hept-6-ene-2,5-dione (PubChem CID 167703724) has the molecular formula C23H44O3 and a molecular weight of 368.60 g/mol. Its IUPAC name is 3-(2,2-diethylbutoxymethyl)-3-ethylpentane;hept-6-ene-2,5-dione.
| Compound Name | 3-(2,2-diethylbutoxymethyl)-3-ethylpentane;hept-6-ene-2,5-dione |
|---|---|
| PubChem CID | 167703724 |
| Molecular Formula | C23H44O3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | 3-(2,2-diethylbutoxymethyl)-3-ethylpentane;hept-6-ene-2,5-dione |
| SMILES | C=CC(=O)CCC(C)=O.CCC(CC)(CC)COCC(CC)(CC)CC |
| InChI | InChI=1S/C16H34O.C7H10O2/c1-7-15(8-2,9-3)13-17-14-16(10-4,11-5)12-6;1-3-7(9)5-4-6(2)8/h7-14H2,1-6H3;3H,1,4-5H2,2H3 |
| InChIKey | YUBHRCIIGWMELT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|