C23H44O9P- — CID 167705535
12-[tert-butyl(methanidyl)phosphoryl]oxy-1-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydodecan-5-one (PubChem CID 167705535) has the molecular formula C23H44O9P- and a molecular weight of 495.57 g/mol. Its IUPAC name is 12-[tert-butyl(methanidyl)phosphoryl]oxy-1-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydodecan-5-one.
| Compound Name | 12-[tert-butyl(methanidyl)phosphoryl]oxy-1-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydodecan-5-one |
|---|---|
| PubChem CID | 167705535 |
| Molecular Formula | C23H44O9P- |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 12-[tert-butyl(methanidyl)phosphoryl]oxy-1-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydodecan-5-one |
| SMILES | [CH2-]P(=O)(OCCCCCCCC(=O)CCCCO[C@H]1OC(CO)[C@@H](O)[C@H](O)C1O)C(C)(C)C |
| InChI | InChI=1S/C23H44O9P/c1-23(2,3)33(4,29)31-15-10-7-5-6-8-12-17(25)13-9-11-14-30-22-21(28)20(27)19(26)18(16-24)32-22/h18-22,24,26-28H,4-16H2,1-3H3/q-1/t18?,19-,20+,21?,22+,33?/m1/s1 |
| InChIKey | ZAWKCPITLZEIPE-SKUFRUGOSA-N |
| XLogP | 2.77 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|