C32H48N4O4 — CID 167705873
(2S,4S)-1-[(2S,5S)-2-cyclohexyl-5-(methylamino)-4-oxohexanoyl]-4-(2-methylpropanoylamino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide (PubChem CID 167705873) has the molecular formula C32H48N4O4 and a molecular weight of 552.76 g/mol. Its IUPAC name is (2S,4S)-1-[(2S,5S)-2-cyclohexyl-5-(methylamino)-4-oxohexanoyl]-4-(2-methylpropanoylamino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(2S,5S)-2-cyclohexyl-5-(methylamino)-4-oxohexanoyl]-4-(2-methylpropanoylamino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167705873 |
| Molecular Formula | C32H48N4O4 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | (2S,4S)-1-[(2S,5S)-2-cyclohexyl-5-(methylamino)-4-oxohexanoyl]-4-(2-methylpropanoylamino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
| SMILES | CN[C@@H](C)C(=O)C[C@H](C(=O)N1C[C@@H](NC(=O)C(C)C)C[C@H]1C(=O)NC1CCCc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C32H48N4O4/c1-20(2)30(38)34-24-17-28(31(39)35-27-16-10-14-22-13-8-9-15-25(22)27)36(19-24)32(40)26(18-29(37)21(3)33-4)23-11-6-5-7-12-23/h8-9,13,15,20-21,23-24,26-28,33H,5-7,10-12,14,16-19H2,1-4H3,(H,34,38)(H,35,39)/t21-,24-,26-,27?,28-/m0/s1 |
| InChIKey | ZCDRTKHFZFGHBP-NTBOSDIHSA-N |
| XLogP | 3.69 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |