C23H33N5O5 — CID 167705999
[1-[2-[(4-hydroxy-4-methylpiperidine-1-carbonyl)amino]-4-methoxy-3H-indol-7-yl]piperidin-3-yl]methyl carbamate (PubChem CID 167705999) has the molecular formula C23H33N5O5 and a molecular weight of 459.55 g/mol. Its IUPAC name is [1-[2-[(4-hydroxy-4-methylpiperidine-1-carbonyl)amino]-4-methoxy-3H-indol-7-yl]piperidin-3-yl]methyl carbamate.
| Compound Name | [1-[2-[(4-hydroxy-4-methylpiperidine-1-carbonyl)amino]-4-methoxy-3H-indol-7-yl]piperidin-3-yl]methyl carbamate |
|---|---|
| PubChem CID | 167705999 |
| Molecular Formula | C23H33N5O5 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | [1-[2-[(4-hydroxy-4-methylpiperidine-1-carbonyl)amino]-4-methoxy-3H-indol-7-yl]piperidin-3-yl]methyl carbamate |
| SMILES | COc1ccc(N2CCCC(COC(N)=O)C2)c2c1CC(NC(=O)N1CCC(C)(O)CC1)=N2 |
| InChI | InChI=1S/C23H33N5O5/c1-23(31)7-10-27(11-8-23)22(30)26-19-12-16-18(32-2)6-5-17(20(16)25-19)28-9-3-4-15(13-28)14-33-21(24)29/h5-6,15,31H,3-4,7-14H2,1-2H3,(H2,24,29)(H,25,26,30) |
| InChIKey | ZCOOCBIRGUYZOY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|