C19H37N3O2S — CID 167707491
N-(2-cyclohexylpropan-2-yl)methanesulfonamide;methane;2-pyridin-3-ylpropan-2-amine (PubChem CID 167707491) has the molecular formula C19H37N3O2S and a molecular weight of 371.59 g/mol. Its IUPAC name is N-(2-cyclohexylpropan-2-yl)methanesulfonamide;methane;2-pyridin-3-ylpropan-2-amine.
| Compound Name | N-(2-cyclohexylpropan-2-yl)methanesulfonamide;methane;2-pyridin-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 167707491 |
| Molecular Formula | C19H37N3O2S |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(2-cyclohexylpropan-2-yl)methanesulfonamide;methane;2-pyridin-3-ylpropan-2-amine |
| SMILES | C.CC(C)(N)c1cccnc1.CC(C)(NS(C)(=O)=O)C1CCCCC1 |
| InChI | InChI=1S/C10H21NO2S.C8H12N2.CH4/c1-10(2,11-14(3,12)13)9-7-5-4-6-8-9;1-8(2,9)7-4-3-5-10-6-7;/h9,11H,4-8H2,1-3H3;3-6H,9H2,1-2H3;1H4 |
| InChIKey | ZHYXDVXPUSZISO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |