C41H32N4O5 — CID 167713212
4-[[7-phenyl-2-[4-[2-[(4-pyridin-2-ylphenyl)methoxy]ethyl]phenyl]imidazo[1,2-a]pyridin-3-yl]amino]phthalic acid (PubChem CID 167713212) has the molecular formula C41H32N4O5 and a molecular weight of 660.73 g/mol. Its IUPAC name is 4-[[7-phenyl-2-[4-[2-[(4-pyridin-2-ylphenyl)methoxy]ethyl]phenyl]imidazo[1,2-a]pyridin-3-yl]amino]phthalic acid.
| Compound Name | 4-[[7-phenyl-2-[4-[2-[(4-pyridin-2-ylphenyl)methoxy]ethyl]phenyl]imidazo[1,2-a]pyridin-3-yl]amino]phthalic acid |
|---|---|
| PubChem CID | 167713212 |
| Molecular Formula | C41H32N4O5 |
| Molecular Weight | 660.73 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 4-[[7-phenyl-2-[4-[2-[(4-pyridin-2-ylphenyl)methoxy]ethyl]phenyl]imidazo[1,2-a]pyridin-3-yl]amino]phthalic acid |
| SMILES | O=C(O)c1ccc(Nc2c(-c3ccc(CCOCc4ccc(-c5ccccn5)cc4)cc3)nc3cc(-c4ccccc4)ccn23)cc1C(=O)O |
| InChI | InChI=1S/C41H32N4O5/c46-40(47)34-18-17-33(25-35(34)41(48)49)43-39-38(44-37-24-32(19-22-45(37)39)29-6-2-1-3-7-29)31-15-9-27(10-16-31)20-23-50-26-28-11-13-30(14-12-28)36-8-4-5-21-42-36/h1-19,21-22,24-25,43H,20,23,26H2,(H,46,47)(H,48,49) |
| InChIKey | ZNDWCDSQYLVCOS-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.73 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|