C11H14N2 — CID 167713504
2,3,3a,4,4a,5-hexahydro-1H-pyrrolo[2,3-g]isoquinoline (PubChem CID 167713504) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3,3a,4,4a,5-hexahydro-1H-pyrrolo[2,3-g]isoquinoline.
| Compound Name | 2,3,3a,4,4a,5-hexahydro-1H-pyrrolo[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 167713504 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3,3a,4,4a,5-hexahydro-1H-pyrrolo[2,3-g]isoquinoline |
| SMILES | C1=NCC2CC3CCNC3=CC2=C1 |
| InChI | InChI=1S/C11H14N2/c1-3-12-7-10-5-9-2-4-13-11(9)6-8(1)10/h1,3,6,9-10,13H,2,4-5,7H2 |
| InChIKey | PBKRUFSOCXAPIU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |