C22H28N4O3 — CID 167714894
3-[6-[[2-(3-azabicyclo[3.2.0]heptan-1-yl)ethylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167714894) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-[6-[[2-(3-azabicyclo[3.2.0]heptan-1-yl)ethylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[2-(3-azabicyclo[3.2.0]heptan-1-yl)ethylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167714894 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 3-[6-[[2-(3-azabicyclo[3.2.0]heptan-1-yl)ethylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CNCCC45CCC4CNC5)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H28N4O3/c27-19-4-3-18(20(28)25-19)26-12-15-9-14(1-2-17(15)21(26)29)10-23-8-7-22-6-5-16(22)11-24-13-22/h1-2,9,16,18,23-24H,3-8,10-13H2,(H,25,27,28) |
| InChIKey | FJEVVBPBIUBVHR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|