C24H24N4O4 — CID 167715437
5-[[2,3-dihydro-1H-isoindol-4-ylmethyl(methyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167715437) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-[[2,3-dihydro-1H-isoindol-4-ylmethyl(methyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[2,3-dihydro-1H-isoindol-4-ylmethyl(methyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167715437 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 5-[[2,3-dihydro-1H-isoindol-4-ylmethyl(methyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CN(Cc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)Cc1cccc2c1CNC2 |
| InChI | InChI=1S/C24H24N4O4/c1-27(13-16-4-2-3-15-10-25-11-19(15)16)12-14-5-6-17-18(9-14)24(32)28(23(17)31)20-7-8-21(29)26-22(20)30/h2-6,9,20,25H,7-8,10-13H2,1H3,(H,26,29,30) |
| InChIKey | QFEBIBCLIVUQDD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|