C23H33N5O5 — CID 167716352
4-[[4-[3-aminopropyl(2-hydroxyethyl)amino]butylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167716352) has the molecular formula C23H33N5O5 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[[4-[3-aminopropyl(2-hydroxyethyl)amino]butylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[4-[3-aminopropyl(2-hydroxyethyl)amino]butylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167716352 |
| Molecular Formula | C23H33N5O5 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 4-[[4-[3-aminopropyl(2-hydroxyethyl)amino]butylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NCCCN(CCO)CCCCNCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H33N5O5/c24-9-4-12-27(13-14-29)11-2-1-10-25-15-16-5-3-6-17-20(16)23(33)28(22(17)32)18-7-8-19(30)26-21(18)31/h3,5-6,18,25,29H,1-2,4,7-15,24H2,(H,26,30,31) |
| InChIKey | NPMXQWXZGUEZMJ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|