C23H25N5O3 — CID 167717903
3-[3-oxo-5-[(3-pyridin-3-ylpiperazin-1-yl)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167717903) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-[3-oxo-5-[(3-pyridin-3-ylpiperazin-1-yl)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-5-[(3-pyridin-3-ylpiperazin-1-yl)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167717903 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 3-[3-oxo-5-[(3-pyridin-3-ylpiperazin-1-yl)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CN4CCNC(c5cccnc5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H25N5O3/c29-21-6-5-20(22(30)26-21)28-13-17-4-3-15(10-18(17)23(28)31)12-27-9-8-25-19(14-27)16-2-1-7-24-11-16/h1-4,7,10-11,19-20,25H,5-6,8-9,12-14H2,(H,26,29,30) |
| InChIKey | IVABEMZOWYHFNA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|