C21H21N5O3 — CID 167735356
3-[5-(2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-ylmethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167735356) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-[5-(2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-ylmethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-(2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-ylmethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167735356 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-[5-(2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-ylmethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CN4CCNc5cccnc54)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H21N5O3/c27-18-6-5-17(20(28)24-18)26-12-14-4-3-13(10-15(14)21(26)29)11-25-9-8-22-16-2-1-7-23-19(16)25/h1-4,7,10,17,22H,5-6,8-9,11-12H2,(H,24,27,28) |
| InChIKey | TZGUWCJXFQXLAW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|