C20H25N7O3 — CID 167720593
3-[5-[[[1-[(2S)-2-aminopropyl]triazol-4-yl]methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167720593) has the molecular formula C20H25N7O3 and a molecular weight of 411.47 g/mol. Its IUPAC name is 3-[5-[[[1-[(2S)-2-aminopropyl]triazol-4-yl]methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[[1-[(2S)-2-aminopropyl]triazol-4-yl]methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167720593 |
| Molecular Formula | C20H25N7O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 3-[5-[[[1-[(2S)-2-aminopropyl]triazol-4-yl]methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C[C@H](N)Cn1cc(CNCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)nn1 |
| InChI | InChI=1S/C20H25N7O3/c1-12(21)9-26-11-15(24-25-26)8-22-7-13-2-3-14-10-27(20(30)16(14)6-13)17-4-5-18(28)23-19(17)29/h2-3,6,11-12,17,22H,4-5,7-10,21H2,1H3,(H,23,28,29)/t12-,17?/m0/s1 |
| InChIKey | WLTKIADRLOAPEO-WHUIICBVSA-N |
| XLogP | -0.32 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|