C21H26F2N4O3 — CID 167721807
3-[7-[[(1-amino-4,4-difluorocyclohexyl)methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167721807) has the molecular formula C21H26F2N4O3 and a molecular weight of 420.46 g/mol. Its IUPAC name is 3-[7-[[(1-amino-4,4-difluorocyclohexyl)methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[(1-amino-4,4-difluorocyclohexyl)methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167721807 |
| Molecular Formula | C21H26F2N4O3 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-[7-[[(1-amino-4,4-difluorocyclohexyl)methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC1(CNCc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CCC(F)(F)CC1 |
| InChI | InChI=1S/C21H26F2N4O3/c22-21(23)8-6-20(24,7-9-21)12-25-10-13-2-1-3-14-15(13)11-27(19(14)30)16-4-5-17(28)26-18(16)29/h1-3,16,25H,4-12,24H2,(H,26,28,29) |
| InChIKey | YIBWGJAYHBHGDA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|