C19H22F2N4O3 — CID 167730335
3-[7-[[(4,4-difluoropyrrolidin-3-yl)methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167730335) has the molecular formula C19H22F2N4O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is 3-[7-[[(4,4-difluoropyrrolidin-3-yl)methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[(4,4-difluoropyrrolidin-3-yl)methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167730335 |
| Molecular Formula | C19H22F2N4O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-[7-[[(4,4-difluoropyrrolidin-3-yl)methylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CNCC4CNCC4(F)F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H22F2N4O3/c20-19(21)10-23-8-12(19)7-22-6-11-2-1-3-13-14(11)9-25(18(13)28)15-4-5-16(26)24-17(15)27/h1-3,12,15,22-23H,4-10H2,(H,24,26,27) |
| InChIKey | FRYCDCKELQWDDA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|