C23H26N4O4 — CID 167722447
5-(4,8-diazatricyclo[5.2.2.02,6]undecan-8-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167722447) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 5-(4,8-diazatricyclo[5.2.2.02,6]undecan-8-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-(4,8-diazatricyclo[5.2.2.02,6]undecan-8-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167722447 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 5-(4,8-diazatricyclo[5.2.2.02,6]undecan-8-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN4CC5CCC4C4CNCC54)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H26N4O4/c28-20-6-5-19(21(29)25-20)27-22(30)14-3-1-12(7-15(14)23(27)31)10-26-11-13-2-4-18(26)17-9-24-8-16(13)17/h1,3,7,13,16-19,24H,2,4-6,8-11H2,(H,25,28,29) |
| InChIKey | GXNWFXCINSABPO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|