C22H26N6O3 — CID 167724062
3-[3-oxo-6-[[(2-piperidin-3-ylpyrazol-3-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167724062) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-[3-oxo-6-[[(2-piperidin-3-ylpyrazol-3-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[(2-piperidin-3-ylpyrazol-3-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167724062 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3-[3-oxo-6-[[(2-piperidin-3-ylpyrazol-3-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CNc4ccnn4C4CCCNC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H26N6O3/c29-20-6-5-18(21(30)26-20)27-13-15-10-14(3-4-17(15)22(27)31)11-24-19-7-9-25-28(19)16-2-1-8-23-12-16/h3-4,7,9-10,16,18,23-24H,1-2,5-6,8,11-13H2,(H,26,29,30) |
| InChIKey | BEMYABKSYXUAMM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|