C24H30N4O5 — CID 167726868
2-(2,6-dioxopiperidin-3-yl)-5-[(1-oxa-9-azaspiro[5.5]undecan-2-ylmethylamino)methyl]isoindole-1,3-dione (PubChem CID 167726868) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[(1-oxa-9-azaspiro[5.5]undecan-2-ylmethylamino)methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[(1-oxa-9-azaspiro[5.5]undecan-2-ylmethylamino)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167726868 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[(1-oxa-9-azaspiro[5.5]undecan-2-ylmethylamino)methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CNCC4CCCC5(CCNCC5)O4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H30N4O5/c29-20-6-5-19(21(30)27-20)28-22(31)17-4-3-15(12-18(17)23(28)32)13-26-14-16-2-1-7-24(33-16)8-10-25-11-9-24/h3-4,12,16,19,25-26H,1-2,5-11,13-14H2,(H,27,29,30) |
| InChIKey | QRSLCHBLMMVUTN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|