C26H36N4O3 — CID 167727191
3-[6-[[3-(2-amino-2-cyclopentylethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167727191) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3-[6-[[3-(2-amino-2-cyclopentylethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[3-(2-amino-2-cyclopentylethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167727191 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 3-[6-[[3-(2-amino-2-cyclopentylethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC(CC1CCCN(Cc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1)C1CCCC1 |
| InChI | InChI=1S/C26H36N4O3/c27-22(19-5-1-2-6-19)13-17-4-3-11-29(14-17)15-18-7-8-21-20(12-18)16-30(26(21)33)23-9-10-24(31)28-25(23)32/h7-8,12,17,19,22-23H,1-6,9-11,13-16,27H2,(H,28,31,32) |
| InChIKey | POLGMCRPQPSDLE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|