C8H14O2 — CID 167728298
4,4-diethyloxolan-3-one (PubChem CID 167728298) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 4,4-diethyloxolan-3-one.
| Compound Name | 4,4-diethyloxolan-3-one |
|---|---|
| PubChem CID | 167728298 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 4,4-diethyloxolan-3-one |
| SMILES | CCC1(CC)COCC1=O |
| InChI | InChI=1S/C8H14O2/c1-3-8(4-2)6-10-5-7(8)9/h3-6H2,1-2H3 |
| InChIKey | XZJJLKMAQVKFHZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |