C24H36O2 — CID 139037270
1,1,7,7-tetraethyl-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene-4,8-dione (PubChem CID 139037270) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1,1,7,7-tetraethyl-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene-4,8-dione.
| Compound Name | 1,1,7,7-tetraethyl-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene-4,8-dione |
|---|---|
| PubChem CID | 139037270 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 1,1,7,7-tetraethyl-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene-4,8-dione |
| SMILES | CCC1(CC)CC(C)(C)C2=C1C(=O)C1=C(C2=O)C(C)(C)CC1(CC)CC |
| InChI | InChI=1S/C24H36O2/c1-9-23(10-2)13-21(5,6)15-17(23)20(26)18-16(19(15)25)22(7,8)14-24(18,11-3)12-4/h9-14H2,1-8H3 |
| InChIKey | JPUYMAKGHSXGCT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|