C24H37S- — CID 102477634
1,1,7,7-tetraethyl-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene-4-thiolate (PubChem CID 102477634) has the molecular formula C24H37S- and a molecular weight of 357.63 g/mol. Its IUPAC name is 1,1,7,7-tetraethyl-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene-4-thiolate.
| Compound Name | 1,1,7,7-tetraethyl-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene-4-thiolate |
|---|---|
| PubChem CID | 102477634 |
| Molecular Formula | C24H37S- |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 357.26 |
| IUPAC Name | 1,1,7,7-tetraethyl-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene-4-thiolate |
| SMILES | CCC1(CC)CC(C)(C)c2c1cc1c(c2[S-])C(C)(C)CC1(CC)CC |
| InChI | InChI=1S/C24H38S/c1-9-23(10-2)14-21(5,6)18-16(23)13-17-19(20(18)25)22(7,8)15-24(17,11-3)12-4/h13,25H,9-12,14-15H2,1-8H3/p-1 |
| InChIKey | QAWLEUJIKWTYSQ-UHFFFAOYSA-M |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|