C30H51BO2 — CID 177455219
dimethoxy-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)borane (PubChem CID 177455219) has the molecular formula C30H51BO2 and a molecular weight of 454.55 g/mol. Its IUPAC name is dimethoxy-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)borane.
| Compound Name | dimethoxy-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)borane |
|---|---|
| PubChem CID | 177455219 |
| Molecular Formula | C30H51BO2 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.40 |
| IUPAC Name | dimethoxy-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)borane |
| SMILES | CCC1(CC)CC(CC)(CC)c2c1cc1c(c2B(OC)OC)C(CC)(CC)CC1(CC)CC |
| InChI | InChI=1S/C30H51BO2/c1-11-27(12-2)20-29(15-5,16-6)24-22(27)19-23-25(26(24)31(32-9)33-10)30(17-7,18-8)21-28(23,13-3)14-4/h19H,11-18,20-21H2,1-10H3 |
| InChIKey | VXHOPQOBWUTWME-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|