C42H80B2O8 — CID 10652542
(4-dimethoxyboranyl-2,3,5,6-tetraoctoxyphenyl)-dimethoxyborane (PubChem CID 10652542) has the molecular formula C42H80B2O8 and a molecular weight of 734.72 g/mol. Its IUPAC name is (4-dimethoxyboranyl-2,3,5,6-tetraoctoxyphenyl)-dimethoxyborane.
| Compound Name | (4-dimethoxyboranyl-2,3,5,6-tetraoctoxyphenyl)-dimethoxyborane |
|---|---|
| PubChem CID | 10652542 |
| Molecular Formula | C42H80B2O8 |
| Molecular Weight | 734.72 g/mol |
| Exact Mass | 734.60 |
| IUPAC Name | (4-dimethoxyboranyl-2,3,5,6-tetraoctoxyphenyl)-dimethoxyborane |
| SMILES | CCCCCCCCOc1c(OCCCCCCCC)c(B(OC)OC)c(OCCCCCCCC)c(OCCCCCCCC)c1B(OC)OC |
| InChI | InChI=1S/C42H80B2O8/c1-9-13-17-21-25-29-33-49-39-37(43(45-5)46-6)41(51-35-31-27-23-19-15-11-3)42(52-36-32-28-24-20-16-12-4)38(44(47-7)48-8)40(39)50-34-30-26-22-18-14-10-2/h9-36H2,1-8H3 |
| InChIKey | MKQITJYFGWSKMX-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.72 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|