C28H47B — CID 139116456
dideuterio-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)borane (PubChem CID 139116456) has the molecular formula C28H47B and a molecular weight of 396.51 g/mol. Its IUPAC name is dideuterio-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)borane.
| Compound Name | dideuterio-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)borane |
|---|---|
| PubChem CID | 139116456 |
| Molecular Formula | C28H47B |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.39 |
| IUPAC Name | dideuterio-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)borane |
| SMILES | [2H]B([2H])c1c2c(cc3c1C(CC)(CC)CC3(CC)CC)C(CC)(CC)CC2(CC)CC |
| InChI | InChI=1S/C28H47B/c1-9-25(10-2)18-27(13-5,14-6)22-20(25)17-21-23(24(22)29)28(15-7,16-8)19-26(21,11-3)12-4/h17H,9-16,18-19,29H2,1-8H3/i29D2 |
| InChIKey | AWELJNHLRGOZPC-DNBURNPGSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|