C24H37I — CID 132596556
1,1,7,7-tetraethyl-4-iodo-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene (PubChem CID 132596556) has the molecular formula C24H37I and a molecular weight of 452.46 g/mol. Its IUPAC name is 1,1,7,7-tetraethyl-4-iodo-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene.
| Compound Name | 1,1,7,7-tetraethyl-4-iodo-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene |
|---|---|
| PubChem CID | 132596556 |
| Molecular Formula | C24H37I |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1,1,7,7-tetraethyl-4-iodo-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene |
| SMILES | CCC1(CC)CC(C)(C)c2c1cc1c(c2I)C(C)(C)CC1(CC)CC |
| InChI | InChI=1S/C24H37I/c1-9-23(10-2)14-21(5,6)18-16(23)13-17-19(20(18)25)22(7,8)15-24(17,11-3)12-4/h13H,9-12,14-15H2,1-8H3 |
| InChIKey | XZYZJFJDFNIALI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|