C19H30 — CID 91073277
1,1,3,3-tetraethyl-5,6-dimethyl-2H-indene (PubChem CID 91073277) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is 1,1,3,3-tetraethyl-5,6-dimethyl-2H-indene.
| Compound Name | 1,1,3,3-tetraethyl-5,6-dimethyl-2H-indene |
|---|---|
| PubChem CID | 91073277 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1,1,3,3-tetraethyl-5,6-dimethyl-2H-indene |
| SMILES | CCC1(CC)CC(CC)(CC)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C19H30/c1-7-18(8-2)13-19(9-3,10-4)17-12-15(6)14(5)11-16(17)18/h11-12H,7-10,13H2,1-6H3 |
| InChIKey | DIUOOQNQGJCZLQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |