C28H45Sn+ — CID 177395241
CID 177395241 (PubChem CID 177395241) has the molecular formula C28H45Sn+ and a molecular weight of 500.38 g/mol.
| Compound Name | CID 177395241 |
|---|---|
| PubChem CID | 177395241 |
| Molecular Formula | C28H45Sn+ |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | — |
| SMILES | CCC1(CC)CC(CC)(CC)c2c1cc1c(c2[Sn+])C(CC)(CC)CC1(CC)CC |
| InChI | InChI=1S/C28H45.Sn/c1-9-25(10-2)19-26(11-3,12-4)22-18-24-23(17-21(22)25)27(13-5,14-6)20-28(24,15-7)16-8;/h17H,9-16,19-20H2,1-8H3;/q;+1 |
| InChIKey | HBRDIOKHDHWJIM-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |