C38H52Br2Si — CID 102529230
dibromo-naphthalen-1-yl-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)silane (PubChem CID 102529230) has the molecular formula C38H52Br2Si and a molecular weight of 696.73 g/mol. Its IUPAC name is dibromo-naphthalen-1-yl-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)silane.
| Compound Name | dibromo-naphthalen-1-yl-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)silane |
|---|---|
| PubChem CID | 102529230 |
| Molecular Formula | C38H52Br2Si |
| Molecular Weight | 696.73 g/mol |
| Exact Mass | 694.22 |
| IUPAC Name | dibromo-naphthalen-1-yl-(1,1,3,3,5,5,7,7-octaethyl-2,6-dihydro-s-indacen-4-yl)silane |
| SMILES | CCC1(CC)CC(CC)(CC)c2c1cc1c(c2[Si](Br)(Br)c2cccc3ccccc23)C(CC)(CC)CC1(CC)CC |
| InChI | InChI=1S/C38H52Br2Si/c1-9-35(10-2)25-37(13-5,14-6)32-29(35)24-30-33(38(15-7,16-8)26-36(30,11-3)12-4)34(32)41(39,40)31-23-19-21-27-20-17-18-22-28(27)31/h17-24H,9-16,25-26H2,1-8H3 |
| InChIKey | NBAKLPPYHIOJSW-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.73 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|