C19H20N4O4S — CID 167729978
2-(2,6-dioxopiperidin-3-yl)-4-(5-thia-2,8-diazaspiro[3.4]octan-8-ylmethyl)isoindole-1,3-dione (PubChem CID 167729978) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(5-thia-2,8-diazaspiro[3.4]octan-8-ylmethyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(5-thia-2,8-diazaspiro[3.4]octan-8-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167729978 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(5-thia-2,8-diazaspiro[3.4]octan-8-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CN4CCSC45CNC5)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H20N4O4S/c24-14-5-4-13(16(25)21-14)23-17(26)12-3-1-2-11(15(12)18(23)27)8-22-6-7-28-19(22)9-20-10-19/h1-3,13,20H,4-10H2,(H,21,24,25) |
| InChIKey | VBSPLFVSEZLDTN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|