C24H28N4O5 — CID 167730275
5-[[(3aS,6aR)-spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167730275) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 5-[[(3aS,6aR)-spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[(3aS,6aR)-spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167730275 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-[[(3aS,6aR)-spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN4CC5(CCNCC5)[C@@H]5COC[C@@H]54)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H28N4O5/c29-20-4-3-18(21(30)26-20)28-22(31)15-2-1-14(9-16(15)23(28)32)10-27-13-24(5-7-25-8-6-24)17-11-33-12-19(17)27/h1-2,9,17-19,25H,3-8,10-13H2,(H,26,29,30)/t17-,18?,19+/m1/s1 |
| InChIKey | OJFROEBHRUVXJM-KGNCLDLBSA-N |
| XLogP | 0.29 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|