C23H28N4O5 — CID 167717369
2-(2,6-dioxopiperidin-3-yl)-5-[(3-piperidin-2-ylmorpholin-4-yl)methyl]isoindole-1,3-dione (PubChem CID 167717369) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[(3-piperidin-2-ylmorpholin-4-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[(3-piperidin-2-ylmorpholin-4-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167717369 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[(3-piperidin-2-ylmorpholin-4-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN4CCOCC4C4CCCCN4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H28N4O5/c28-20-7-6-18(21(29)25-20)27-22(30)15-5-4-14(11-16(15)23(27)31)12-26-9-10-32-13-19(26)17-3-1-2-8-24-17/h4-5,11,17-19,24H,1-3,6-10,12-13H2,(H,25,28,29) |
| InChIKey | OWZBWHROCPLVOK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|