C9H15NO4 — CID 167730306
1-acetyl-3-methoxypiperidine-2-carboxylic acid (PubChem CID 167730306) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-acetyl-3-methoxypiperidine-2-carboxylic acid.
| Compound Name | 1-acetyl-3-methoxypiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167730306 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-acetyl-3-methoxypiperidine-2-carboxylic acid |
| SMILES | COC1CCCN(C(C)=O)C1C(=O)O |
| InChI | InChI=1S/C9H15NO4/c1-6(11)10-5-3-4-7(14-2)8(10)9(12)13/h7-8H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | KRTLOCZKVGWSKT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |