C23H24N6O4 — CID 167730329
2-(2,6-dioxopiperidin-3-yl)-4-[[(5-piperazin-1-yl-3-pyridinyl)amino]methyl]isoindole-1,3-dione (PubChem CID 167730329) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-piperazin-1-yl-3-pyridinyl)amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-piperazin-1-yl-3-pyridinyl)amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167730329 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-piperazin-1-yl-3-pyridinyl)amino]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNc4cncc(N5CCNCC5)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H24N6O4/c30-19-5-4-18(21(31)27-19)29-22(32)17-3-1-2-14(20(17)23(29)33)11-26-15-10-16(13-25-12-15)28-8-6-24-7-9-28/h1-3,10,12-13,18,24,26H,4-9,11H2,(H,27,30,31) |
| InChIKey | RFXWBGSRVYRSDG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|