C21H22N6O5 — CID 167720947
2-(2,6-dioxopiperidin-3-yl)-4-[[(5-piperidin-4-yl-1,3,4-oxadiazol-2-yl)amino]methyl]isoindole-1,3-dione (PubChem CID 167720947) has the molecular formula C21H22N6O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-piperidin-4-yl-1,3,4-oxadiazol-2-yl)amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-piperidin-4-yl-1,3,4-oxadiazol-2-yl)amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167720947 |
| Molecular Formula | C21H22N6O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-piperidin-4-yl-1,3,4-oxadiazol-2-yl)amino]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNc4nnc(C5CCNCC5)o4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H22N6O5/c28-15-5-4-14(17(29)24-15)27-19(30)13-3-1-2-12(16(13)20(27)31)10-23-21-26-25-18(32-21)11-6-8-22-9-7-11/h1-3,11,14,22H,4-10H2,(H,23,26)(H,24,28,29) |
| InChIKey | INHDHLVLXAUTHQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|