C20H21N7O4 — CID 167722892
2-(2,6-dioxopiperidin-3-yl)-4-[[(5-pyrrolidin-3-yl-1H-1,2,4-triazol-3-yl)amino]methyl]isoindole-1,3-dione (PubChem CID 167722892) has the molecular formula C20H21N7O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-pyrrolidin-3-yl-1H-1,2,4-triazol-3-yl)amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-pyrrolidin-3-yl-1H-1,2,4-triazol-3-yl)amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167722892 |
| Molecular Formula | C20H21N7O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[(5-pyrrolidin-3-yl-1H-1,2,4-triazol-3-yl)amino]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNc4n[nH]c(C5CCNC5)n4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H21N7O4/c28-14-5-4-13(17(29)23-14)27-18(30)12-3-1-2-10(15(12)19(27)31)9-22-20-24-16(25-26-20)11-6-7-21-8-11/h1-3,11,13,21H,4-9H2,(H,23,28,29)(H2,22,24,25,26) |
| InChIKey | OGNXSAWXYBRWBQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|