C17H16N6O4S — CID 167739341
4-[[[3-(aminomethyl)-1,2,4-thiadiazol-5-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167739341) has the molecular formula C17H16N6O4S and a molecular weight of 400.42 g/mol. Its IUPAC name is 4-[[[3-(aminomethyl)-1,2,4-thiadiazol-5-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[[3-(aminomethyl)-1,2,4-thiadiazol-5-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167739341 |
| Molecular Formula | C17H16N6O4S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-[[[3-(aminomethyl)-1,2,4-thiadiazol-5-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NCc1nsc(NCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)n1 |
| InChI | InChI=1S/C17H16N6O4S/c18-6-11-20-17(28-22-11)19-7-8-2-1-3-9-13(8)16(27)23(15(9)26)10-4-5-12(24)21-14(10)25/h1-3,10H,4-7,18H2,(H,19,20,22)(H,21,24,25) |
| InChIKey | OLCQKIZONDPYFH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|