C20H20N6O5 — CID 167723637
2-(2,6-dioxopiperidin-3-yl)-4-[[[4-(methylaminomethyl)-6-oxo-1H-pyrimidin-2-yl]amino]methyl]isoindole-1,3-dione (PubChem CID 167723637) has the molecular formula C20H20N6O5 and a molecular weight of 424.42 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[[4-(methylaminomethyl)-6-oxo-1H-pyrimidin-2-yl]amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[[4-(methylaminomethyl)-6-oxo-1H-pyrimidin-2-yl]amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167723637 |
| Molecular Formula | C20H20N6O5 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[[4-(methylaminomethyl)-6-oxo-1H-pyrimidin-2-yl]amino]methyl]isoindole-1,3-dione |
| SMILES | CNCc1cc(=O)[nH]c(NCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)n1 |
| InChI | InChI=1S/C20H20N6O5/c1-21-9-11-7-15(28)25-20(23-11)22-8-10-3-2-4-12-16(10)19(31)26(18(12)30)13-5-6-14(27)24-17(13)29/h2-4,7,13,21H,5-6,8-9H2,1H3,(H,24,27,29)(H2,22,23,25,28) |
| InChIKey | LGPHBVHPSDYDDB-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 153.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|