C22H22N6O5 — CID 167737708
2-(2,6-dioxopiperidin-3-yl)-4-[[(2-pyrrolidin-3-yloxypyrimidin-4-yl)amino]methyl]isoindole-1,3-dione (PubChem CID 167737708) has the molecular formula C22H22N6O5 and a molecular weight of 450.46 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[(2-pyrrolidin-3-yloxypyrimidin-4-yl)amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[(2-pyrrolidin-3-yloxypyrimidin-4-yl)amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167737708 |
| Molecular Formula | C22H22N6O5 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[(2-pyrrolidin-3-yloxypyrimidin-4-yl)amino]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNc4ccnc(OC5CCNC5)n4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H22N6O5/c29-17-5-4-15(19(30)27-17)28-20(31)14-3-1-2-12(18(14)21(28)32)10-25-16-7-9-24-22(26-16)33-13-6-8-23-11-13/h1-3,7,9,13,15,23H,4-6,8,10-11H2,(H,24,25,26)(H,27,29,30) |
| InChIKey | VSIHPFSSZHUCON-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|