C20H23N7O3S — CID 167731198
3-[3-oxo-4-[[(5-piperazin-1-yl-1,2,4-thiadiazol-3-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167731198) has the molecular formula C20H23N7O3S and a molecular weight of 441.52 g/mol. Its IUPAC name is 3-[3-oxo-4-[[(5-piperazin-1-yl-1,2,4-thiadiazol-3-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-4-[[(5-piperazin-1-yl-1,2,4-thiadiazol-3-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167731198 |
| Molecular Formula | C20H23N7O3S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-[3-oxo-4-[[(5-piperazin-1-yl-1,2,4-thiadiazol-3-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(CNc4nsc(N5CCNCC5)n4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H23N7O3S/c28-15-5-4-14(17(29)23-15)27-11-13-3-1-2-12(16(13)18(27)30)10-22-19-24-20(31-25-19)26-8-6-21-7-9-26/h1-3,14,21H,4-11H2,(H,22,25)(H,23,28,29) |
| InChIKey | QRZRULDTUBQGPM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|