C20H24N4O5 — CID 167731367
5-[[(2S,4R)-2-(aminomethyl)-4-methoxypyrrolidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167731367) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 5-[[(2S,4R)-2-(aminomethyl)-4-methoxypyrrolidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[(2S,4R)-2-(aminomethyl)-4-methoxypyrrolidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167731367 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 5-[[(2S,4R)-2-(aminomethyl)-4-methoxypyrrolidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CO[C@@H]1C[C@@H](CN)N(Cc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C20H24N4O5/c1-29-13-7-12(8-21)23(10-13)9-11-2-3-14-15(6-11)20(28)24(19(14)27)16-4-5-17(25)22-18(16)26/h2-3,6,12-13,16H,4-5,7-10,21H2,1H3,(H,22,25,26)/t12-,13+,16?/m0/s1 |
| InChIKey | CTTOWBQMLCFDON-FTLRAWMYSA-N |
| XLogP | -0.36 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|