C14H27NO2 — CID 167731611
tert-butyl 2-amino-2-(4,4-dimethylcyclohexyl)acetate (PubChem CID 167731611) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is tert-butyl 2-amino-2-(4,4-dimethylcyclohexyl)acetate.
| Compound Name | tert-butyl 2-amino-2-(4,4-dimethylcyclohexyl)acetate |
|---|---|
| PubChem CID | 167731611 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | tert-butyl 2-amino-2-(4,4-dimethylcyclohexyl)acetate |
| SMILES | CC1(C)CCC(C(N)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27NO2/c1-13(2,3)17-12(16)11(15)10-6-8-14(4,5)9-7-10/h10-11H,6-9,15H2,1-5H3 |
| InChIKey | QJMPLHRXNNSHRW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |