C9H15NO3 — CID 167736831
6-oxa-2-azaspiro[4.5]decane-7-carboxylic acid (PubChem CID 167736831) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 6-oxa-2-azaspiro[4.5]decane-7-carboxylic acid.
| Compound Name | 6-oxa-2-azaspiro[4.5]decane-7-carboxylic acid |
|---|---|
| PubChem CID | 167736831 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 6-oxa-2-azaspiro[4.5]decane-7-carboxylic acid |
| SMILES | O=C(O)C1CCCC2(CCNC2)O1 |
| InChI | InChI=1S/C9H15NO3/c11-8(12)7-2-1-3-9(13-7)4-5-10-6-9/h7,10H,1-6H2,(H,11,12) |
| InChIKey | DOVNOOITXNRIED-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |