C10H16O4 — CID 130585145
1,9-dioxaspiro[4.6]undecane-2-carboxylic acid (PubChem CID 130585145) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1,9-dioxaspiro[4.6]undecane-2-carboxylic acid.
| Compound Name | 1,9-dioxaspiro[4.6]undecane-2-carboxylic acid |
|---|---|
| PubChem CID | 130585145 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1,9-dioxaspiro[4.6]undecane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC2(CCCOCC2)O1 |
| InChI | InChI=1S/C10H16O4/c11-9(12)8-2-4-10(14-8)3-1-6-13-7-5-10/h8H,1-7H2,(H,11,12) |
| InChIKey | PGLHLADHUPVLMC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |