C21H28N4O4 — CID 167738766
3-[6-[[(3R,4S)-3-(aminomethyl)-4-ethoxypyrrolidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167738766) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[6-[[(3R,4S)-3-(aminomethyl)-4-ethoxypyrrolidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(3R,4S)-3-(aminomethyl)-4-ethoxypyrrolidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167738766 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-[6-[[(3R,4S)-3-(aminomethyl)-4-ethoxypyrrolidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCO[C@@H]1CN(Cc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C[C@H]1CN |
| InChI | InChI=1S/C21H28N4O4/c1-2-29-18-12-24(10-15(18)8-22)9-13-3-4-16-14(7-13)11-25(21(16)28)17-5-6-19(26)23-20(17)27/h3-4,7,15,17-18H,2,5-6,8-12,22H2,1H3,(H,23,26,27)/t15-,17?,18-/m1/s1 |
| InChIKey | VXIKWQNYHZIGDG-NEBWYHTOSA-N |
| XLogP | 0.24 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|