C16H28BNO6 — CID 167739351
(3S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-3-carboxylic acid (PubChem CID 167739351) has the molecular formula C16H28BNO6 and a molecular weight of 341.21 g/mol. Its IUPAC name is (3S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 167739351 |
| Molecular Formula | C16H28BNO6 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (3S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](B2OC(C)(C)C(C)(C)O2)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C16H28BNO6/c1-14(2,3)22-13(21)18-8-10(12(19)20)11(9-18)17-23-15(4,5)16(6,7)24-17/h10-11H,8-9H2,1-7H3,(H,19,20)/t10-,11-/m1/s1 |
| InChIKey | BHAGQNCJDHVJMD-GHMZBOCLSA-N |
| XLogP | 2.40 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|